Answer:
9.91 mL
Explanation:
Using the combined gas law equation as follows;
P1V1/T1 = P2V2/T2
Where;
P1 = initial pressure (torr)
P2 = final pressure (torr)
V1 = initial volume (mL)
V2 = final volume (mL)
T1 = initial temperature (K)
T2 = final temperature (K)
According to the information provided in this question;
V1 = 15.0mL
V2 = ?
P1 = 760 torr
P2 = 1252 torr
T1 = 10°C = 10 + 273 = 283K
T2 = 35°C = 35 + 273 = 308K
Using P1V1/T1 = P2V2/T2
760 × 15/283 = 1252 × V2/308
11400/283 = 1252V2/308
Cross multiply
11400 × 308 = 283 × 1252V2
3511200 = 354316V2
V2 = 3511200 ÷ 354316
V2 = 9.91 mL
13
Al
Aluminum
Atomic mass 26.982
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Solar- the sun is not always shining, for example at night you can't get any energy from the sun
Wind-it's not always windy
Water- there can be drought
Really the main issue of all three of these is that they are not always available
