Answer:
<em>The type of vegetation a surface does affect the </em><em>water coming from above to sink in or runoff. </em>
Explanation:
This is how the vegetation affects the runoff:-
The leaves and stems present in the vegetation do not let the water fall directly on the soil and makes the process rather slow which makes the water to get to the ground slowly and sink in properly inside the soil rather than running off.
If the vegetation present is dense with there was being hairy then also the water would not run out and will get absorbed by the roots letting the soil intact
Holy I'm not that smart lol but I'll get back to you
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The solutions are ordered by this way (from lowest to highest freezing point): K₃PO₄ < CaCl₂ < NaI < glucose
Option d, b, a and c
Explanation:
Colligative property: Freezing point depression
The formula is: ΔT = Kf . m . i
ΔT = Freezing T° of pure solvent - Freezing T° of solution
We need to determine the i, which is the numbers of ions dissolved. It is also called the Van't Hoff factor.
Option d, which is glucose is non electrolyte so the i = 1
a. NaI → Na⁺ + I⁻ i =2
b. CaCl₂ → Ca²⁺ + 2Cl⁻ i =3
c. K₃PO₄ → 3K⁺ + PO₄⁻³ i=4
Potassium phosphate will have the lowest freezing point, then we have the calcium chloride, the sodium iodide and at the end, glucose.