The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
The extra conversion of concentration of reactant and product should be zero in order to attaining equlibrium state.
<h3>What is equilibrium?</h3>
Chemical equilibrium refers to the state in which both the reactants and products are present in equal concentrations or amount. In equlibrium, same amount of reactant is converted into product and product into reactant.
So we can conclude that the extra conversion of concentration of reactant and product should be zero in order to attaining equlibrium state.
Learn more about equilibrium here: brainly.com/question/517289
Elements because elements make up atoms which make up everything
Answer:
(i) specific heat
(ii) latent heat of vaporization
(iii) latent heat of fusion
Explanation:
i. Q = mcΔT; identify c.
Here, Q is heat, m is the mass, c is the specific heat and ΔT is the change in temperature.
The amount of heat required to raise the temperature of substance of mass 1 kg by 1 degree C is known as the specific heat.
ii. Q = mLvapor; identify Lvapor
Here, Q is the heat, m is the mass and L is the latent heat of vaporization.
The amount of heat required to convert the 1 kg liquid into 1 kg vapor at constant temperature.
iii. Q = mLfusion; identify Lfusion
Here, Q is the heat, m is the mass and L is the latent heat of fusion.
Here, Q is the heat, m is the mass and L is the latent heat of vaporization.
The amount of heat required to convert the 1 kg solid into 1 kg liquid at constant temperature.
Answer:
1,15mL = V₂
Explanation:
Based on Charle's law the volume is directely proportional to the absolute temperature in a gas under constant pressure. The equation is:
V₁T₂ = V₂T₁
<em>Where V is volume and T absolute temperature of a gas where 1 is initial state and 2, final state.</em>
The V₁ is 1.23mL
T₁ = 32°C + 273.15 = 305.15K
T₂ = T₁ - 20°C = 285.15K
Replacing:
1.23mL*285.15K = V₂*305.15K
<h3>1,15mL = V₂</h3>
<em />