The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer: because it consists of more than one element, which are hydrogen and oxygen in a covalent bond.
since the unit for the heat of fusion is kJ/mol, you're going to have to convert the grams into moles in order to cancel out the unit. After that, you can solve like normal.
Answer:
Many years ago, people living on the Earth, desired to go to the outer space.
Explanation:
When man initiate to go outer space:
Many times ago, people used to think about the world out of Earth, the space and the sky. These thoughts generated the idea of thinking and imagining the space and the moon.
The idea turned into a movie by Georges Méliès, which was inspired by a book written by Jules Verne. The movie gave the idea to Konstantin Tsiolkovsky, a Russian man to develop many ideas which were implemented by Russia and America to build airplanes and rockets that we see launching at present.
A small though became an idea which gave birth to a new invention through which people live their dreams of going in the outer space. Incredible!
I mean this is pretty obvious it's D. life expectancy is sort of close but not really. B is close too but it's not it bc that's not what health is. you could be over weight and not be sick and it still isn't healthy. and C isn't close at all. hope this helps, have an amazing day :)