<span>Answer:
mol Al2O3 x 1 mol Al/ 2 mol Al2O3= .25 mol Al
The balanced equation tells us that it takes 4 moles of Al to produce 2 moles of Al2O3.
0.50 moles Al2O3 x (4 moles Al / 2 moles Al2O3) = 1.0 moles Al
1.0 moles Al x (27.0 g Al / 1 mole Al) = 27.0 g Al</span>
I think the answer might be 51.14% since the formula had to equal a 100% just add 41.86 and 6.98 and subtract the sum to 100.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
Xe:[Kr]4d¹⁰5(sp³d³)₆⁺² => Octahedral Geometry (AX₆)⁺²
Explanation:
Xe:[Kr]4d¹⁰(5s²5p₋₁²p₀²p₁²5d₋₂d₋₁d₀)⁺² => Xe[Kr]5(sp³d³)₆²
Ca. #Valence e⁻ = Xe + 6F - 2e⁻ = 1(8) + 6(7) - 2 = 48
Ca. #Substrate e⁻ = 6F = 6(8) = 48
#Nonbonded free pairs e⁻ = (V - S)/2 = (48 - 48)/2 = 0 free pairs
#Bonded pairs e⁻ = 6F substrates = 6 bonded pairs
BPr + NBPr = 6 + 0 = 6 e⁻ pairs => Geometry => [AX₆]⁺² => Octahedron
Xe:[Kr]4d¹⁰(5s²5p₋₁²p₀²p₁²5d₋₂d₋₁d₀)⁺² => Xe[Kr]5(sp³d³)₆⁺²
XeF₆⁺² => 6(sp³d³) hybrid orbitals => Octahedral Geometry (AX₆)
The complete equation representing the synthesis reaction for the formation of ammonia is: 3 H₂ + N₂ ⇒ 2 NH₃
<h3>What is a synthesis reaction?</h3>
It is a reaction in which 2 or more substances combine to form 1 product.
Let's consider the following incomplete synthesis reaction.
3 H₂ + ____ ⇒ 2 NH₃
According to Lavoisier's law, the mass and the elements must be conserved in a chemical reaction. So, since there is nitrogen to the right, the missing element to the left must be nitrogen. Molecular nitrogen is diatomic.
The complete reaction is:
3 H₂ + N₂ ⇒ 2 NH₃
The complete equation representing the synthesis reaction for the formation of ammonia is: 3 H₂ + N₂ ⇒ 2 NH₃
Learn more about synthesis reaction here: brainly.com/question/16560802
#SPJ1