Answer:
Formation of intermolecular hydrogen bonding between water molecules and molecules of n-butanol
Explanation:
Low molecular weight alcohols are miscible with water in all proportions. The reason for this is that, when a low molecular weight alcohol is dissolved in water, intermolecular hydrogen bonds are formed between the low molecular weight alcohol and water molecules.
Low molecular weight alcohols such as n-butanol contain the polar -OH group which interacts with water via hydrogen bonding.
Answer:
eye weakness is caused by deficiency of vitamin A
If the angle is either 0 or 180, that means that there is either negative or positive work, so A and D are not correct.
If the angle is 45, then there is still some work involved.
The only option where there is no work done by a force is B. when the angle is between the force and displacement is 90.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Copper Sulfate (CuSO4) compound is basically comprised of Copper (II) ion and Sulfate ion. Ions are C<span>u2</span>+ and S<span>O4 2</span><span>−</span>.
<em>ANSWER:</em><em>Cu 2+ and SO4 2-</em>