Answer:
Relative atomic mass or atomic weight is a dimensionless physical quantity defined as the ratio of the average mass of atoms of a chemical element in a given sample to the atomic mass constant. The atomic mass constant is defined as being 1/12 of the mass of a carbon-12 atom.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
A weak bond between two molecules resulting from an electrostatic attraction between a proton in one molecule and an electronegative atom in another
Answer:
I think the answer is A!!!
Answer:
22.46
Explanation:
.There are 3.79 liters in one gallon
