Please help me on this!!

Submit Quiz Previous Page 1 of 4 Next Drag and drop each description to match the subatomic particle. Protons Neutrons Drag and

Pavel [41]

Answer:

Protons:

Positively charged particle

The number of these is the atomic number

All atoms of a given element have the same number of these

Neutrons:

Neutral particles

Isotopes of a given element differ in the number of these

The mass number is the number of these added to the number of protons

Explanation:

Protons (positively charged), neutrons (neutral) and electrons (negatively charged) are smaller than an atom and they are the main subatomic particles. The nucleus of an atom is composed of protons and neutrons, and the electrons are in the periphery at unknown pathways.

The Atomic number (Z) indicates the number of protons ( $P^{+}$ ) in the nucleus. Every atom of an element have the same atomic number, thus the same number of protons.

The mass number (A) is the sum of the number of protons ( $P^{+}$ ) and neutrons (N) that are present in the nucleus: A= Z + N

Isotopes are atoms of the same element which nucleus have the same atomic number (Z), and different mass number (A), it means the same number of protons ( $P^{+}$ ) and a different number of neutrons (N). For example, the oxygen in its natural state is a mixture of isotopes:

99.8% atoms with A= 16, Z=8, and N=8

0.037% atoms with A=17, Z=8, and N=9

0.204% atoms with A=18, Z=8, and N=10

3 0

3 years ago

For each set of reactions, determine the value of δh2 in terms of δh1. a+b→2c,δh1 1/2a+1/2b→c,δh2=? express your answer in terms

allochka39001 [22]

ΔH2 = - δH1 δH2 = - 2 x δH1 δH2 = 2 x δH1

3 0

2 years ago

Why is the composition of Earth's atmosphere different from the composition of the atmospheres of Venus and Mars? A. Venus, Mars

rewona [7]

Answer:

they all have different chemical compositions from earth

Venus is more filled with carbon dioxide and nitrogen

earth is filled more with oxygen and nitrogen

mars is filled more with carbon dioxide and carbon monoxide

so ur answer is C

it cant be B as scientists and NASA are still in the look out for life, D has nothing to do with chemicals and atmosphere, and its not A cuz they all dont have the same similiar chemical.

~batmans wife dun dun dun....

6 0

2 years ago

the atomic number of an element x is 14 and its relative atomic mass is 28 write the electronic distribution in an atom of x

AlekseyPX

Answer:

the electronic distribution in an atom of x is 14

3 0

2 years ago

Balance this equation Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)

zzz [600]

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)

3 0

3 years ago