Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
We determine the limiting reactant by using the moles present in the equation and the actual moles.
According to equation, ratio of Fe₂O₃ : Al = 1 : 2
Actual moles of Fe₂O₃ = 187.3 / (56 x 2 + 16 x 3)
= 1.17
Actual moles of Al = 94.51 / 27
= 3.5
Fe₂O₃ is limiting. Fe₂O₃ required:
(moles Al)/2 = 3.5/2 = 1.75
Moles to be added = 1.75 - 1.17
= 0.58
Mass to be added = moles x Mr
= 0.58 x (56 x 2 + 16 x 3)
= 92.8 grams
Answer: 6.48m/s
Explanation:
From the question given, we obtained the following:
M = 50 kg
Velocity =?
Momentum = 324 kg•m/s
Momentum = Mass x Velocity
Velocity = momentum /Mass
Velocity = 324 / 50
Velocity = 6.48m/s
Answer:
n₂ =1.4 mol
Explanation:
Given data:
Mass of nitrogen = 2 g
Initial Volume occupy by nitrogen = 1.25 L
Final volume occupy by nitrogen = 25.0 L
Final number of moles = ?
Solution;
Formula:
V₁ / n₁ = V₂ / n₂
Number of moles of nitrogen:
Number of moles = mass/ molar mass
Number of moles = 2 g/ 28 g/mol
Number of moles = 0.07 mol
Now we will put the values in formula:
V₁ / n₁ = V₂ / n₂
n₂ = V₂× n₁ /V₁
n₂ = 25 L × 0.07 mol / 1.25 L
n₂ = 1.75 L. mol / 1.25 L
n₂ =1.4 mol
Chlorine atom has 17 electrons. It<span> has seven </span>valence electrons<span>. These seven electrons make </span>chlorine<span> a very reactive element. A </span>valence electron<span> is an </span>electron<span> that is associated with an atom, and that can participate in the formation of a chemical bond. Hope this helps.</span>
