Answer:
i will think c-n=3 to NM=2
Answer:
The gas was N₂
Explanation:
V = 3.6L
P = 2.0 atm
T = 24.0°C = 297K
R = 0.0821 L.atm/K.mol
m = 8.3g
M = molar mass = ?
Using ideal gas equation;
PV = nRT
n = no. Of moles = mass / molar mass
n = m/M
PV = m/M * RT
M = mRT / PV
M = (8.3*0.0821*297) / (2.0*3.6)
M = 28.10
Since X is a diatomic molecule
M = 28.10 / 2 = 14.05 g/mol
M = Nitrogen
X = N₂
Answer:
Explanation: Mendeleev arranged the elements on the basis of their atomic mass. Melting and boiling point were used as the physical characteristics in deciding the position of elements. He arranged the elements and wrote the formula of their oxides and hydrides which seemed to possess same chemical formula.
Explanation:
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
AgNO3+NaCl yields AgCl+NaNo3 (reduction)
...that's the only one I know