Co2 = two covalent bonds
ccl4 = 4 covalent bonds
Lih = covalent bond
The correct answer among the choices given is the first option.The teacher most likely is talking about distillation of a mixture. Distillation is a unit operation that separates component substances from a liquid mixture which is shown by the teacher. Also, the most common purifying technique in the production of gasoline is by this process.
Answer:
A. 8
Explanation:
8 valence electrons means you have a full shell.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
AsF3:C2CI6
4:3
1.3618 moles: 1.02135 moles(1.3618÷4×3)
C2CI6 is the limting reagent
So the number of moles for AsCI3 is 0.817 moles( number of moles of the limting reagant) ÷3 ×4 (according to ratio by balancing chemical equation)=1.09 moles(3 s.f.)
or
Balanced equation
4AsF3 + 3C2Cl6 → 4AsCl3 + 3C2Cl2F4
Use stoichiometry to calculate the moles of AsCl3 that can be produced by each reactant.
Multiply the moles of each reactant by the mole ratio between it and AsCl3 in the balanced equation, so that the moles of the reactant cancel, leaving moles of AsCl3.
Explanation:
