Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
The water molecules will flow from b to a due to osmosis.
Osmosis is where water molecules will flow from a region of higher water potential to a region of lower water potential, through a selectively permeable membrane.
When the water molecule concentration is higher, it has a higher water potential top. Water potential is the tendency for them to flow to a lower region.
The net movement will stop until both sides of the solution has a same water potential.
Answer:
The concentration of H⁺ in a 2.5 M HCl solution is 2.5 M
Explanation:
As HCl is a strong acid and hence a strong electrolyte, it will dissociate as
HCl ⟶ H⁺ + Cl⁻
So, The concentration of H⁺ will be 2.5 M (same as HCl)
Thus, The concentration of H⁺ in a 2.5 M HCl solution is 2.5 M
<u>-TheUnknownScientist</u><u> 72</u>
The light bulbs ave to be a part of the loop in order for it to be successful because it have to have wires to a circuit breaker so you can see.
