Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer: Option (b) is the correct answer.
Explanation:
A covalent bond is defined as the bond which occurs due to sharing of electrons between the combining atoms.
Generally, a covalent bond is formed between non-metals.
For example, both nitrogen and oxygen atoms are non-metals and they combine covalently to form compound.
As nitrogen has 5 valence electrons and an oxygen atom has 6 valence electrons. So, there occurs unequal sharing of electrons between the two.
Thus, we can conclude that when a covalent bond forms then electrons in valence shells are shared between atoms.
I believe the correct answer is the first option. To increase the molar concentration of the product N2O4, you should increase the pressure of the system. You cannot determine the effect of changing the temperature since we cannot tell whether it is an endothermic or an exothermic reaction. Also, decreasing the number of NO2 would not increase the product rather it would shift the equilibrium to the left forming more reactants. The only parameter we can change would be the pressure. And, since NO2 takes up more space than the product increasing the pressure would allow the reactant to collide more forming the product.
The balanced equation is attached in the image below. The coefficients are 2, 2, blank.
Answer:
17.55 g of NaCl
Explanation:
The following data were obtained from the question:
Molarity = 3 M
Volume = 100.0 mL
Mass of NaCl =..?
Next, we shall convert 100.0 mL to L. This can be obtained as follow:
1000 mL = 1 L
Therefore,
100 mL = 100/1000
100 mL = 0.1 L
Therefore, 100 mL is equivalent to 0.1 L.
Next, we shall determine the number of mole NaCl in the solution. This can be obtained as follow:
Molarity = 3 M
Volume = 0.1 L
Mole of NaCl =?
Molarity = mole /Volume
3 = mole of NaCl /0.1
Cross multiply
Mole of NaCl = 3 × 0.1
Mole of NaCl = 0.3 mole
Finally, we determine the mass of NaCl required to prepare the solution as follow:
Mole of NaCl = 0.3 mole
Molar mass of NaCl = 23 + 35.5 = 58.5 g/mol
Mass of NaCl =?
Mole = mass /Molar mass
0.3 = mass of NaCl /58.5
Cross multiply
Mass of NaCl = 0.3 × 58.5
Mass of NaCl = 17.55 g
Therefore, 17.55 g of NaCl is needed to prepare the solution.