Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Explanation:
Steaming up or fogging happens when steam condenses on the mirror. Steam emerging from hot water can condense on a colder surface. That’s the reason you can see the result on a mirror instantaneously. Obviously, for a bathroom mirror to steam up, the steam that originates at the shower spray (or the bathtub) has to travel through the cooler air to reach the mirror. Since air tends to heat up easily, the mirror can steam up fast.
Explanation:
There are several ways to define acids and bases, but pH and pOH refer to hydrogen ion concentration and hydroxide ion concentration, respectively. The "p" in pH and pOH stands for "negative logarithm of" and is used to make it easier to work with extremely large or small values. pH and pOH are only meaningful when applied to aqueous (water-based) solutions. When water dissociates it yields a hydrogen ion and a hydroxide.
Answer:
a) Volume of vial= 9.626cm3
b) Mass of vial with water = 62.92 g
Explanation:
a) Mass of empty vial = 55.32 g
Mass of Vial + Hg = 185.56 g
Therefore,
Density of Hg = 13.53 g/cm3
b) Volume of water = volume of vial = 9.626 cm3
Density of water = 0.997 g/cm3
Answer:
When an atom gains or loses energy, the energy of an electron can change.
An electron in an atom can move from one energy level to another when the atom gains or loses energy.
Explanation:
The possible energies that electrons in an atom
can have are called energy levels.
• An electron cannot exist between energy levels.
https://1.cdn.edl.io/tTlW7xRtvD62xSe7RcZlJr7kSR7XsL93akcgJkbGJBNNcpwY.pdf
*this link can also help* brainly ist plz