All categories

2 years ago

Part AWhat happens to the water molecules whenheat is added?

2 answers:

8 0

Molecules in a gas have lots of energy and spread out even more than molecules in a liquid. Warm water has more energy than cold water, which means that molecules in warm water move faster than molecules in cold water

Varvara68 [4.7K]2 years ago

4 0

Heat is essentially energy, so when you add heat to water molecules, they move around more.

Eventually, once enough heat is added, water molecules will be able to escape the Inter-Molecular Forces that hold them together and keep them as liquid. The molecules will be able to move around freely, and take on the form of steam.

If you need me to explain this in more depth, let me know.
-T.B.

You might be interested in

Write the appropriate symbol for each of the following isotopes: (a) Z 74, A 186; (b) Z 80, A 201; (c) Z 34, A 76; (d) Z 94, A 2

beks73 [17]

Answer: a) $_{74}^{186}\textrm{W}$

b) $_{80}^{201}\textrm{Hg}$

c) $_{34}^{76}\textrm{Se}$

d) $_{94}^{239}\textrm{Pu}$

Explanation:

General representation of an element is given as:_Z^A\textrm{X}

where,

Z represents Atomic number

A represents Mass number

X represents the symbol of an element

Mass number is defined as the sum of number of protons and neutrons that are present in an atom.

Mass number = Number of protons + Number of neutrons

In an atom, when neutrons or protons are lost or gains, it directly affects the mass number of an atom.

Atomic number is defined as the number of protons or number of electrons that are present in an atom.

It is characteristic of a particular element.

Atomic number = Number of electrons = Number of proton

a) Z 74, A 186: $_{74}^{186}\textrm{W}$

b) Z 80, A 201: $_{80}^{201}\textrm{Hg}$

c) Z 34, A 76: $_{34}^{76}\textrm{Se}$

d) Z 94, A 239.: $_{94}^{239}\textrm{Pu}$

6 0

2 years ago

What is a substrate?

Anestetic [448]

Answer:

D. a reactant that is catalyzed by an enzyme

Explanation:

search engime

7 0

1 year ago

Titanium has five common isotopes: 46Ti (8.0%), 47Ti (7.8%), 48Ti (73.4%), 49Ti (5.5%), 50Ti (5.3%). What is the average atomic

NNADVOKAT [17]

Hey there!:

Isotopes : abundance :

46 Ti 8.0%

47 Ti 7.8 %

48 Ti 73.4 %

49 Ti 5.5 %

50 Ti 5.3 %

Weighted average = ∑ Wa * % / 100

Therefore:

( 46 * 8.0) + (47 * 7.8 ) + (48 * 73.4 ) + ( 49 * 5.5 ) + ( 50*5.3 ) / 100 =

4792.3 / 100

= 47.923 a.m.u

Hope that helps!

7 0

2 years ago

G what is the difference between the sidechains of leucine and isoleucine? select one:

statuscvo [17]

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

4 0

2 years ago

Which statement correctly describes the actual yield and the theoretical yield of a reaction? (1 point)

Furkat [3]

Answer:

C: The actual yield depends on the reaction conditions, but the theoretical yield varies only with reactant amounts

Explanation:

Looking at the options, the correct one is Option C because the actual yield usually depends on the conditions of the reaction, while the theoretical yield usually varies with only the amount of reactant.

8 0

2 years ago

Part AWhat happens to the water molecules whenheat is added?​

Part AWhat happens to the water molecules whenheat is added?