Answer:
In a neutral molecule, the sum of the bonding valance electrons must be equal. So the products of the negative element and its charges and the positive element and its charge must be equal.
Explanation:
C1×N1 = C2×N2
If we have a 3 valance electrons , the 'A' charge will be either +3 or -5 for a full octet and valance electron in 'B' atoms will mostly result in acquisition of additional electrons (2) for an octet and relative charge of -2.
Balancing the two,
3 × A = -2 × B
To be equal, A = 2 and B = 3
Therefore, A²B³
Answer:
Ans: 2
Explanation:
The concentration of reactants and the concentration of products are constant.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs